C31H42F2N4O4S — CID 118373802
(2S,3R)-2-amino-N-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3-fluorophenyl]-3-[(2S,4S)-2-ethyloxan-4-yl]-3-(4-fluorophenyl)propanamide (PubChem CID 118373802) has the molecular formula C31H42F2N4O4S and a molecular weight of 604.76 g/mol. Its IUPAC name is (2S,3R)-2-amino-N-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3-fluorophenyl]-3-[(2S,4S)-2-ethyloxan-4-yl]-3-(4-fluorophenyl)propanamide.
| Compound Name | (2S,3R)-2-amino-N-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3-fluorophenyl]-3-[(2S,4S)-2-ethyloxan-4-yl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 118373802 |
| Molecular Formula | C31H42F2N4O4S |
| Molecular Weight | 604.76 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | (2S,3R)-2-amino-N-[2-[2-[(6R,9S)-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decan-9-yl]ethyl]-3-fluorophenyl]-3-[(2S,4S)-2-ethyloxan-4-yl]-3-(4-fluorophenyl)propanamide |
| SMILES | CC[C@H]1C[C@@H]([C@H](c2ccc(F)cc2)[C@H](N)C(=O)Nc2cccc(F)c2CC[C@H]2CN[C@@H]3CCCS(=O)(=O)N2C3)CCO1 |
| InChI | InChI=1S/C31H42F2N4O4S/c1-2-25-17-21(14-15-41-25)29(20-8-10-22(32)11-9-20)30(34)31(38)36-28-7-3-6-27(33)26(28)13-12-24-18-35-23-5-4-16-42(39,40)37(24)19-23/h3,6-11,21,23-25,29-30,35H,2,4-5,12-19,34H2,1H3,(H,36,38)/t21-,23+,24-,25-,29-,30-/m0/s1 |
| InChIKey | YHIUNLDDODORBB-SYMAXVROSA-N |
| XLogP | 3.92 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |