C33H40F2N4O3S — CID 126664420
(2S,3S)-2-amino-3-(2,3-dihydro-1H-inden-5-yl)-N-[2-[2-(2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide (PubChem CID 126664420) has the molecular formula C33H40F2N4O3S and a molecular weight of 610.77 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-(2,3-dihydro-1H-inden-5-yl)-N-[2-[2-(2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | (2S,3S)-2-amino-3-(2,3-dihydro-1H-inden-5-yl)-N-[2-[2-(2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 126664420 |
| Molecular Formula | C33H40F2N4O3S |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | (2S,3S)-2-amino-3-(2,3-dihydro-1H-inden-5-yl)-N-[2-[2-(2,2-dihydroxy-2λ4-thia-1,7-diazabicyclo[4.3.1]decan-9-yl)ethyl]-3-fluorophenyl]-3-(4-fluorophenyl)propanamide |
| SMILES | N[C@H](C(=O)Nc1cccc(F)c1CCC1CNC2CCCS(O)(O)N1C2)[C@@H](c1ccc(F)cc1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C33H40F2N4O3S/c34-25-13-11-22(12-14-25)31(24-10-9-21-4-1-5-23(21)18-24)32(36)33(40)38-30-8-2-7-29(35)28(30)16-15-27-19-37-26-6-3-17-43(41,42)39(27)20-26/h2,7-14,18,26-27,31-32,37,41-42H,1,3-6,15-17,19-20,36H2,(H,38,40)/t26?,27?,31-,32-/m0/s1 |
| InChIKey | FIAADRGOGGKZAS-IFTRWUBBSA-N |
| XLogP | 5.59 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |