C14H20N4OS — CID 118374362
N-carbamothioyl-2-[3-(piperazin-1-ylmethyl)phenyl]acetamide (PubChem CID 118374362) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is N-carbamothioyl-2-[3-(piperazin-1-ylmethyl)phenyl]acetamide.
| Compound Name | N-carbamothioyl-2-[3-(piperazin-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 118374362 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-carbamothioyl-2-[3-(piperazin-1-ylmethyl)phenyl]acetamide |
| SMILES | NC(=S)NC(=O)Cc1cccc(CN2CCNCC2)c1 |
| InChI | InChI=1S/C14H20N4OS/c15-14(20)17-13(19)9-11-2-1-3-12(8-11)10-18-6-4-16-5-7-18/h1-3,8,16H,4-7,9-10H2,(H3,15,17,19,20) |
| InChIKey | KDMBBAOLQGDSTK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|