C27H29N3O3 — CID 68892701
2-[3-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methylcarbamoyl]phenyl]acetic acid (PubChem CID 68892701) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-[3-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methylcarbamoyl]phenyl]acetic acid.
| Compound Name | 2-[3-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methylcarbamoyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 68892701 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2-[3-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methylcarbamoyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(C(=O)NCc2cccc(-c3cccc(CN4CCNCC4)c3)c2)c1 |
| InChI | InChI=1S/C27H29N3O3/c31-26(32)17-20-4-1-9-25(14-20)27(33)29-18-21-5-2-7-23(15-21)24-8-3-6-22(16-24)19-30-12-10-28-11-13-30/h1-9,14-16,28H,10-13,17-19H2,(H,29,33)(H,31,32) |
| InChIKey | ANQDMRFOOPVQKD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |