C28H28N4O — CID 11396455
N-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]quinoline-8-carboxamide (PubChem CID 11396455) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]quinoline-8-carboxamide.
| Compound Name | N-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 11396455 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N-[[3-[3-(piperazin-1-ylmethyl)phenyl]phenyl]methyl]quinoline-8-carboxamide |
| SMILES | O=C(NCc1cccc(-c2cccc(CN3CCNCC3)c2)c1)c1cccc2cccnc12 |
| InChI | InChI=1S/C28H28N4O/c33-28(26-11-3-7-23-10-4-12-30-27(23)26)31-19-21-5-1-8-24(17-21)25-9-2-6-22(18-25)20-32-15-13-29-14-16-32/h1-12,17-18,29H,13-16,19-20H2,(H,31,33) |
| InChIKey | SMYCXTYEAKJTDF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |