C22H17N5O3 — CID 171504971
N-[[2-[(3-hydroxypyridine-2-carbonyl)amino]-4-pyridinyl]methyl]quinoline-8-carboxamide (PubChem CID 171504971) has the molecular formula C22H17N5O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is N-[[2-[(3-hydroxypyridine-2-carbonyl)amino]-4-pyridinyl]methyl]quinoline-8-carboxamide.
| Compound Name | N-[[2-[(3-hydroxypyridine-2-carbonyl)amino]-4-pyridinyl]methyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 171504971 |
| Molecular Formula | C22H17N5O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[[2-[(3-hydroxypyridine-2-carbonyl)amino]-4-pyridinyl]methyl]quinoline-8-carboxamide |
| SMILES | O=C(Nc1cc(CNC(=O)c2cccc3cccnc23)ccn1)c1ncccc1O |
| InChI | InChI=1S/C22H17N5O3/c28-17-7-3-10-25-20(17)22(30)27-18-12-14(8-11-23-18)13-26-21(29)16-6-1-4-15-5-2-9-24-19(15)16/h1-12,28H,13H2,(H,26,29)(H,23,27,30) |
| InChIKey | AUJDIWYGRITQLQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |