C22H30N6O — CID 118375410
4-[[(1R,3S)-3-methylcycloheptyl]amino]-2-[[(6R)-5,6,7,8-tetrahydroquinolin-6-yl]amino]pyrimidine-5-carboxamide (PubChem CID 118375410) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-[[(1R,3S)-3-methylcycloheptyl]amino]-2-[[(6R)-5,6,7,8-tetrahydroquinolin-6-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | 4-[[(1R,3S)-3-methylcycloheptyl]amino]-2-[[(6R)-5,6,7,8-tetrahydroquinolin-6-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118375410 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 4-[[(1R,3S)-3-methylcycloheptyl]amino]-2-[[(6R)-5,6,7,8-tetrahydroquinolin-6-yl]amino]pyrimidine-5-carboxamide |
| SMILES | C[C@H]1CCCC[C@@H](Nc2nc(N[C@@H]3CCc4ncccc4C3)ncc2C(N)=O)C1 |
| InChI | InChI=1S/C22H30N6O/c1-14-5-2-3-7-16(11-14)26-21-18(20(23)29)13-25-22(28-21)27-17-8-9-19-15(12-17)6-4-10-24-19/h4,6,10,13-14,16-17H,2-3,5,7-9,11-12H2,1H3,(H2,23,29)(H2,25,26,27,28)/t14-,16+,17+/m0/s1 |
| InChIKey | MIEOQQIIWNKGNK-USXIJHARSA-N |
| XLogP | 3.32 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |