About 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid)
2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid) (PubChem CID 118376983) has the molecular formula C8H18O6S3
and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid).
Molecular Properties
| Compound Name | 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid) |
| PubChem CID | 118376983 |
| Molecular Formula | C8H18O6S3 |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid) |
| SMILES | O=C(O)CS.O=C(O)CS.OCCSCCO |
| InChI | InChI=1S/C4H10O2S.2C2H4O2S/c5-1-3-7-4-2-6;2*3-2(4)1-5/h5-6H,1-4H2;2*5H,1H2,(H,3,4) |
| InChIKey | PGILEVNTXKHSHZ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid)?
The IUPAC name of 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid) (CID 118376983) is 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid).
What is the SMILES notation for 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid)?
The canonical SMILES for 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid) is O=C(O)CS.O=C(O)CS.OCCSCCO.
What is the InChIKey of 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid)?
The InChIKey is PGILEVNTXKHSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2S.2C2H4O2S/c5-1-3-7-4-2-6;2*3-2(4)1-5/h5-6H,1-4H2;2*5H,1H2,(H,3,4).
What are the key properties of 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid)?
2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid) has a molecular weight of 306.43 g/mol, XLogP of -0.29, 6 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethylsulfanyl)ethanol;bis(2-sulfanylacetic acid) is sourced from PubChem (CID 118376983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).