C8H14O6S2 — CID 174828911
3-(2-carboxyethylsulfanyl)propanoic acid;2-sulfanylacetic acid (PubChem CID 174828911) has the molecular formula C8H14O6S2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-(2-carboxyethylsulfanyl)propanoic acid;2-sulfanylacetic acid.
| Compound Name | 3-(2-carboxyethylsulfanyl)propanoic acid;2-sulfanylacetic acid |
|---|---|
| PubChem CID | 174828911 |
| Molecular Formula | C8H14O6S2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 3-(2-carboxyethylsulfanyl)propanoic acid;2-sulfanylacetic acid |
| SMILES | O=C(O)CCSCCC(=O)O.O=C(O)CS |
| InChI | InChI=1S/C6H10O4S.C2H4O2S/c7-5(8)1-3-11-4-2-6(9)10;3-2(4)1-5/h1-4H2,(H,7,8)(H,9,10);5H,1H2,(H,3,4) |
| InChIKey | TZEXUEVIFWMIJU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|