C26H22N4O5 — CID 118377159
7-(2-methoxy-4-nitrophenoxy)-2-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-3H-isoindol-1-one (PubChem CID 118377159) has the molecular formula C26H22N4O5 and a molecular weight of 470.49 g/mol. Its IUPAC name is 7-(2-methoxy-4-nitrophenoxy)-2-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-3H-isoindol-1-one.
| Compound Name | 7-(2-methoxy-4-nitrophenoxy)-2-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 118377159 |
| Molecular Formula | C26H22N4O5 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 7-(2-methoxy-4-nitrophenoxy)-2-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-3H-isoindol-1-one |
| SMILES | COc1cc([N+](=O)[O-])ccc1Oc1cccc2c1C(=O)N(Cc1ccc(-c3cnn(C)c3)cc1)C2 |
| InChI | InChI=1S/C26H22N4O5/c1-28-15-20(13-27-28)18-8-6-17(7-9-18)14-29-16-19-4-3-5-23(25(19)26(29)31)35-22-11-10-21(30(32)33)12-24(22)34-2/h3-13,15H,14,16H2,1-2H3 |
| InChIKey | OLORWSWBVNWRIW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|