C29H29N3O3 — CID 118377450
2-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-7-(3-phenylmethoxypropoxy)-3H-isoindol-1-one (PubChem CID 118377450) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-7-(3-phenylmethoxypropoxy)-3H-isoindol-1-one.
| Compound Name | 2-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-7-(3-phenylmethoxypropoxy)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 118377450 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 2-[[4-(1-methylpyrazol-4-yl)phenyl]methyl]-7-(3-phenylmethoxypropoxy)-3H-isoindol-1-one |
| SMILES | Cn1cc(-c2ccc(CN3Cc4cccc(OCCCOCc5ccccc5)c4C3=O)cc2)cn1 |
| InChI | InChI=1S/C29H29N3O3/c1-31-19-26(17-30-31)24-13-11-22(12-14-24)18-32-20-25-9-5-10-27(28(25)29(32)33)35-16-6-15-34-21-23-7-3-2-4-8-23/h2-5,7-14,17,19H,6,15-16,18,20-21H2,1H3 |
| InChIKey | FYFYRZMPXSEHBQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|