C24H25N3O3 — CID 118377456
7-(2-hydroxycyclohexyl)oxy-2-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-3H-isoindol-1-one (PubChem CID 118377456) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 7-(2-hydroxycyclohexyl)oxy-2-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-3H-isoindol-1-one.
| Compound Name | 7-(2-hydroxycyclohexyl)oxy-2-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 118377456 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 7-(2-hydroxycyclohexyl)oxy-2-[[4-(1H-pyrazol-5-yl)phenyl]methyl]-3H-isoindol-1-one |
| SMILES | O=C1c2c(cccc2OC2CCCCC2O)CN1Cc1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C24H25N3O3/c28-20-5-1-2-6-21(20)30-22-7-3-4-18-15-27(24(29)23(18)22)14-16-8-10-17(11-9-16)19-12-13-25-26-19/h3-4,7-13,20-21,28H,1-2,5-6,14-15H2,(H,25,26) |
| InChIKey | PFKSWXNSWMIEMN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |