C22H24N2O4 — CID 90167158
4-[[4-[(1S,2S)-2-hydroxycyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]methyl]benzamide (PubChem CID 90167158) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-[[4-[(1S,2S)-2-hydroxycyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]methyl]benzamide.
| Compound Name | 4-[[4-[(1S,2S)-2-hydroxycyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 90167158 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-[[4-[(1S,2S)-2-hydroxycyclohexyl]oxy-3-oxo-1H-isoindol-2-yl]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN2Cc3cccc(O[C@H]4CCCC[C@@H]4O)c3C2=O)cc1 |
| InChI | InChI=1S/C22H24N2O4/c23-21(26)15-10-8-14(9-11-15)12-24-13-16-4-3-7-19(20(16)22(24)27)28-18-6-2-1-5-17(18)25/h3-4,7-11,17-18,25H,1-2,5-6,12-13H2,(H2,23,26)/t17-,18-/m0/s1 |
| InChIKey | RDAWCCARCFQRRC-ROUUACIJSA-N |
| XLogP | 2.62 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |