C19H15BrFNO4 — CID 11837717
[2-(4-bromophenyl)-2-oxoethyl] 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 11837717) has the molecular formula C19H15BrFNO4 and a molecular weight of 420.23 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 11837717 |
| Molecular Formula | C19H15BrFNO4 |
| Molecular Weight | 420.23 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)C1CC(=O)N(c2ccc(F)cc2)C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H15BrFNO4/c20-14-3-1-12(2-4-14)17(23)11-26-19(25)13-9-18(24)22(10-13)16-7-5-15(21)6-8-16/h1-8,13H,9-11H2 |
| InChIKey | ADYKOLJRHRNVEU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |