C24H18BrNO7 — CID 40877942
[2-[4-(furan-2-carbonyloxy)phenyl]-2-oxoethyl] (3S)-1-(4-bromophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 40877942) has the molecular formula C24H18BrNO7 and a molecular weight of 512.31 g/mol. Its IUPAC name is [2-[4-(furan-2-carbonyloxy)phenyl]-2-oxoethyl] (3S)-1-(4-bromophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-[4-(furan-2-carbonyloxy)phenyl]-2-oxoethyl] (3S)-1-(4-bromophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 40877942 |
| Molecular Formula | C24H18BrNO7 |
| Molecular Weight | 512.31 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | [2-[4-(furan-2-carbonyloxy)phenyl]-2-oxoethyl] (3S)-1-(4-bromophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)[C@H]1CC(=O)N(c2ccc(Br)cc2)C1)c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C24H18BrNO7/c25-17-5-7-18(8-6-17)26-13-16(12-22(26)28)23(29)32-14-20(27)15-3-9-19(10-4-15)33-24(30)21-2-1-11-31-21/h1-11,16H,12-14H2/t16-/m0/s1 |
| InChIKey | WMQUFXQNLJVEGA-INIZCTEOSA-N |
| XLogP | 4.04 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|