C27H28F2N4O3 — CID 118378358
4-[1-[2-(2,6-difluorophenyl)acetyl]piperidin-4-yl]-N-(3,5-dimethylphenoxy)-2-methylpyrimidine-5-carboxamide (PubChem CID 118378358) has the molecular formula C27H28F2N4O3 and a molecular weight of 494.54 g/mol. Its IUPAC name is 4-[1-[2-(2,6-difluorophenyl)acetyl]piperidin-4-yl]-N-(3,5-dimethylphenoxy)-2-methylpyrimidine-5-carboxamide.
| Compound Name | 4-[1-[2-(2,6-difluorophenyl)acetyl]piperidin-4-yl]-N-(3,5-dimethylphenoxy)-2-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118378358 |
| Molecular Formula | C27H28F2N4O3 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 4-[1-[2-(2,6-difluorophenyl)acetyl]piperidin-4-yl]-N-(3,5-dimethylphenoxy)-2-methylpyrimidine-5-carboxamide |
| SMILES | Cc1cc(C)cc(ONC(=O)c2cnc(C)nc2C2CCN(C(=O)Cc3c(F)cccc3F)CC2)c1 |
| InChI | InChI=1S/C27H28F2N4O3/c1-16-11-17(2)13-20(12-16)36-32-27(35)22-15-30-18(3)31-26(22)19-7-9-33(10-8-19)25(34)14-21-23(28)5-4-6-24(21)29/h4-6,11-13,15,19H,7-10,14H2,1-3H3,(H,32,35) |
| InChIKey | CJNJERJOCQMAGX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|