C27H25F5N4O2 — CID 154344622
2-(2,6-difluorophenyl)-1-[4-[2-methyl-5-[C-methyl-N-[3-(trifluoromethyl)phenoxy]carbonimidoyl]pyrimidin-4-yl]piperidin-1-yl]ethanone (PubChem CID 154344622) has the molecular formula C27H25F5N4O2 and a molecular weight of 532.51 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1-[4-[2-methyl-5-[C-methyl-N-[3-(trifluoromethyl)phenoxy]carbonimidoyl]pyrimidin-4-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-(2,6-difluorophenyl)-1-[4-[2-methyl-5-[C-methyl-N-[3-(trifluoromethyl)phenoxy]carbonimidoyl]pyrimidin-4-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 154344622 |
| Molecular Formula | C27H25F5N4O2 |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1-[4-[2-methyl-5-[C-methyl-N-[3-(trifluoromethyl)phenoxy]carbonimidoyl]pyrimidin-4-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=NOc1cccc(C(F)(F)F)c1)c1cnc(C)nc1C1CCN(C(=O)Cc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C27H25F5N4O2/c1-16(35-38-20-6-3-5-19(13-20)27(30,31)32)22-15-33-17(2)34-26(22)18-9-11-36(12-10-18)25(37)14-21-23(28)7-4-8-24(21)29/h3-8,13,15,18H,9-12,14H2,1-2H3 |
| InChIKey | XRRVWYIQNVFRRH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|