C23H32N8O7S — CID 118380045
tert-butyl 2-[(Z)-[1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-oxo-2-[[(3S,4R)-2-oxo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]amino]ethylidene]amino]oxypropanoate (PubChem CID 118380045) has the molecular formula C23H32N8O7S and a molecular weight of 564.63 g/mol. Its IUPAC name is tert-butyl 2-[(Z)-[1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-oxo-2-[[(3S,4R)-2-oxo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]amino]ethylidene]amino]oxypropanoate.
| Compound Name | tert-butyl 2-[(Z)-[1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-oxo-2-[[(3S,4R)-2-oxo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]amino]ethylidene]amino]oxypropanoate |
|---|---|
| PubChem CID | 118380045 |
| Molecular Formula | C23H32N8O7S |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | tert-butyl 2-[(Z)-[1-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]-2-oxo-2-[[(3S,4R)-2-oxo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]amino]ethylidene]amino]oxypropanoate |
| SMILES | CC(O/N=C(\C(=O)N[C@@H]1C(=O)N[C@@H]1Cn1cncn1)c1csc(NC(=O)OC(C)(C)C)n1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H32N8O7S/c1-12(19(34)36-22(2,3)4)38-30-16(14-9-39-20(27-14)29-21(35)37-23(5,6)7)18(33)28-15-13(26-17(15)32)8-31-11-24-10-25-31/h9-13,15H,8H2,1-7H3,(H,26,32)(H,28,33)(H,27,29,35)/b30-16-/t12?,13-,15+/m1/s1 |
| InChIKey | BAPGOWZMTCCTNY-IKPUYVPZSA-N |
| XLogP | 1.22 |
| TPSA | 188.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|