C14H16N8O8S2 — CID 118380146
(2R)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-[[(3S,4R)-2-oxo-1-sulfo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]amino]ethylidene]amino]oxypropanoic acid (PubChem CID 118380146) has the molecular formula C14H16N8O8S2 and a molecular weight of 488.46 g/mol. Its IUPAC name is (2R)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-[[(3S,4R)-2-oxo-1-sulfo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]amino]ethylidene]amino]oxypropanoic acid.
| Compound Name | (2R)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-[[(3S,4R)-2-oxo-1-sulfo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]amino]ethylidene]amino]oxypropanoic acid |
|---|---|
| PubChem CID | 118380146 |
| Molecular Formula | C14H16N8O8S2 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | (2R)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxo-2-[[(3S,4R)-2-oxo-1-sulfo-4-(1,2,4-triazol-1-ylmethyl)azetidin-3-yl]amino]ethylidene]amino]oxypropanoic acid |
| SMILES | C[C@@H](O/N=C(\C(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)[C@@H]1Cn1cncn1)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C14H16N8O8S2/c1-6(13(25)26)30-20-9(7-3-31-14(15)18-7)11(23)19-10-8(2-21-5-16-4-17-21)22(12(10)24)32(27,28)29/h3-6,8,10H,2H2,1H3,(H2,15,18)(H,19,23)(H,25,26)(H,27,28,29)/b20-9-/t6-,8-,10+/m1/s1 |
| InChIKey | PWSBDPIAWYIDCX-WYXQHCIPSA-N |
| XLogP | -2.29 |
| TPSA | 232.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|