C16H20N8O8S2 — CID 118379702
2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3S)-2-[(3-methyl-1,2,4-triazol-1-yl)methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 118379702) has the molecular formula C16H20N8O8S2 and a molecular weight of 516.52 g/mol. Its IUPAC name is 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3S)-2-[(3-methyl-1,2,4-triazol-1-yl)methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3S)-2-[(3-methyl-1,2,4-triazol-1-yl)methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 118379702 |
| Molecular Formula | C16H20N8O8S2 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3S)-2-[(3-methyl-1,2,4-triazol-1-yl)methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | Cc1ncn(C[C@@H]2[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c3csc(N)n3)C(=O)N2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C16H20N8O8S2/c1-7-18-6-23(21-7)4-9-11(13(26)24(9)34(29,30)31)20-12(25)10(8-5-33-15(17)19-8)22-32-16(2,3)14(27)28/h5-6,9,11H,4H2,1-3H3,(H2,17,19)(H,20,25)(H,27,28)(H,29,30,31)/b22-10-/t9-,11+/m1/s1 |
| InChIKey | DBBIDSDRSMKEQN-QLLXEVRMSA-N |
| XLogP | -1.59 |
| TPSA | 232.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|