C15H19N9O8S2 — CID 118393781
2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S)-2-[(5-methyltetrazol-2-yl)methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 118393781) has the molecular formula C15H19N9O8S2 and a molecular weight of 517.51 g/mol. Its IUPAC name is 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S)-2-[(5-methyltetrazol-2-yl)methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S)-2-[(5-methyltetrazol-2-yl)methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 118393781 |
| Molecular Formula | C15H19N9O8S2 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S)-2-[(5-methyltetrazol-2-yl)methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | Cc1nnn(C[C@H]2C(NC(=O)/C(=N\OC(C)(C)C(=O)O)c3csc(N)n3)C(=O)N2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C15H19N9O8S2/c1-6-19-22-23(20-6)4-8-10(12(26)24(8)34(29,30)31)18-11(25)9(7-5-33-14(16)17-7)21-32-15(2,3)13(27)28/h5,8,10H,4H2,1-3H3,(H2,16,17)(H,18,25)(H,27,28)(H,29,30,31)/b21-9-/t8-,10?/m0/s1 |
| InChIKey | CNYMQHYAAYFMGN-RZEKUXDLSA-N |
| XLogP | -2.20 |
| TPSA | 245.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|