C15H20N10O8S2 — CID 139321723
2-[(Z)-[2-[[2-[[5-(aminomethyl)tetrazol-1-yl]methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 139321723) has the molecular formula C15H20N10O8S2 and a molecular weight of 532.52 g/mol. Its IUPAC name is 2-[(Z)-[2-[[2-[[5-(aminomethyl)tetrazol-1-yl]methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(Z)-[2-[[2-[[5-(aminomethyl)tetrazol-1-yl]methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 139321723 |
| Molecular Formula | C15H20N10O8S2 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 2-[(Z)-[2-[[2-[[5-(aminomethyl)tetrazol-1-yl]methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(O/N=C(\C(=O)NC1C(=O)N(S(=O)(=O)O)C1Cn1nnnc1CN)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C15H20N10O8S2/c1-15(2,13(28)29)33-21-9(6-5-34-14(17)18-6)11(26)19-10-7(25(12(10)27)35(30,31)32)4-24-8(3-16)20-22-23-24/h5,7,10H,3-4,16H2,1-2H3,(H2,17,18)(H,19,26)(H,28,29)(H,30,31,32)/b21-9- |
| InChIKey | LPHXMDFSHMOABK-NKVSQWTQSA-N |
| XLogP | -3.05 |
| TPSA | 271.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|