C17H23N9O8S2 — CID 123701798
2-[[2-[[2-[[1-(2-aminoethyl)triazol-4-yl]methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 123701798) has the molecular formula C17H23N9O8S2 and a molecular weight of 545.56 g/mol. Its IUPAC name is 2-[[2-[[2-[[1-(2-aminoethyl)triazol-4-yl]methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[1-(2-aminoethyl)triazol-4-yl]methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 123701798 |
| Molecular Formula | C17H23N9O8S2 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | 2-[[2-[[2-[[1-(2-aminoethyl)triazol-4-yl]methyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(ON=C(C(=O)NC1C(=O)N(S(=O)(=O)O)C1Cc1cn(CCN)nn1)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C17H23N9O8S2/c1-17(2,15(29)30)34-23-11(9-7-35-16(19)20-9)13(27)21-12-10(26(14(12)28)36(31,32)33)5-8-6-25(4-3-18)24-22-8/h6-7,10,12H,3-5,18H2,1-2H3,(H2,19,20)(H,21,27)(H,29,30)(H,31,32,33) |
| InChIKey | ZKEYOMLLMKDOEI-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 258.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|