C17H22N8O8S2 — CID 172940085
2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S)-2-[2-(3-methyl-1,2,4-triazol-1-yl)ethyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 172940085) has the molecular formula C17H22N8O8S2 and a molecular weight of 530.55 g/mol. Its IUPAC name is 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S)-2-[2-(3-methyl-1,2,4-triazol-1-yl)ethyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S)-2-[2-(3-methyl-1,2,4-triazol-1-yl)ethyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 172940085 |
| Molecular Formula | C17H22N8O8S2 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S)-2-[2-(3-methyl-1,2,4-triazol-1-yl)ethyl]-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | Cc1ncn(CCC2[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c3csc(N)n3)C(=O)N2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C17H22N8O8S2/c1-8-19-7-24(22-8)5-4-10-12(14(27)25(10)35(30,31)32)21-13(26)11(9-6-34-16(18)20-9)23-33-17(2,3)15(28)29/h6-7,10,12H,4-5H2,1-3H3,(H2,18,20)(H,21,26)(H,28,29)(H,30,31,32)/b23-11-/t10?,12-/m0/s1 |
| InChIKey | UZXVFPKJPVSONZ-HEYLBHBZSA-N |
| XLogP | -1.20 |
| TPSA | 232.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|