C11H9Br2N3O3 — CID 118382196
N-(2,4-dibromophenyl)-2-(2,5-dioxoimidazolidin-4-yl)acetamide (PubChem CID 118382196) has the molecular formula C11H9Br2N3O3 and a molecular weight of 391.02 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-2-(2,5-dioxoimidazolidin-4-yl)acetamide.
| Compound Name | N-(2,4-dibromophenyl)-2-(2,5-dioxoimidazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 118382196 |
| Molecular Formula | C11H9Br2N3O3 |
| Molecular Weight | 391.02 g/mol |
| Exact Mass | 388.90 |
| IUPAC Name | N-(2,4-dibromophenyl)-2-(2,5-dioxoimidazolidin-4-yl)acetamide |
| SMILES | O=C(CC1NC(=O)NC1=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H9Br2N3O3/c12-5-1-2-7(6(13)3-5)14-9(17)4-8-10(18)16-11(19)15-8/h1-3,8H,4H2,(H,14,17)(H2,15,16,18,19) |
| InChIKey | DSRXQTYCQUNQSC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.02 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|