C15H16Br2N4O2S — CID 137195599
2-[(5S)-2-(butan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-dibromophenyl)acetamide (PubChem CID 137195599) has the molecular formula C15H16Br2N4O2S and a molecular weight of 476.19 g/mol. Its IUPAC name is 2-[(5S)-2-(butan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-dibromophenyl)acetamide.
| Compound Name | 2-[(5S)-2-(butan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-dibromophenyl)acetamide |
|---|---|
| PubChem CID | 137195599 |
| Molecular Formula | C15H16Br2N4O2S |
| Molecular Weight | 476.19 g/mol |
| Exact Mass | 473.94 |
| IUPAC Name | 2-[(5S)-2-(butan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-dibromophenyl)acetamide |
| SMILES | CCC(C)=NN=C1NC(=O)[C@H](CC(=O)Nc2ccc(Br)cc2Br)S1 |
| InChI | InChI=1S/C15H16Br2N4O2S/c1-3-8(2)20-21-15-19-14(23)12(24-15)7-13(22)18-11-5-4-9(16)6-10(11)17/h4-6,12H,3,7H2,1-2H3,(H,18,22)(H,19,21,23)/t12-/m0/s1 |
| InChIKey | IERMPCPSJULIFX-LBPRGKRZSA-N |
| XLogP | 3.91 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|