C19H23BrN4O2S — CID 136914461
N-(4-bromophenyl)-2-[2-(1-cyclohexylethylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 136914461) has the molecular formula C19H23BrN4O2S and a molecular weight of 451.39 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[2-(1-cyclohexylethylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[2-(1-cyclohexylethylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 136914461 |
| Molecular Formula | C19H23BrN4O2S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N-(4-bromophenyl)-2-[2-(1-cyclohexylethylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC(=NN=C1NC(=O)C(CC(=O)Nc2ccc(Br)cc2)S1)C1CCCCC1 |
| InChI | InChI=1S/C19H23BrN4O2S/c1-12(13-5-3-2-4-6-13)23-24-19-22-18(26)16(27-19)11-17(25)21-15-9-7-14(20)8-10-15/h7-10,13,16H,2-6,11H2,1H3,(H,21,25)(H,22,24,26) |
| InChIKey | NUCZQLXLTNVIID-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|