C20H24N4O3S — CID 136858491
N-(4-acetylphenyl)-2-[(2Z,5S)-2-(cycloheptylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 136858491) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[(2Z,5S)-2-(cycloheptylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-[(2Z,5S)-2-(cycloheptylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 136858491 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-(4-acetylphenyl)-2-[(2Z,5S)-2-(cycloheptylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)C[C@@H]2S/C(=N\N=C3CCCCCC3)NC2=O)cc1 |
| InChI | InChI=1S/C20H24N4O3S/c1-13(25)14-8-10-15(11-9-14)21-18(26)12-17-19(27)22-20(28-17)24-23-16-6-4-2-3-5-7-16/h8-11,17H,2-7,12H2,1H3,(H,21,26)(H,22,24,27)/t17-/m0/s1 |
| InChIKey | MKEWKYOSAHPCQY-KRWDZBQOSA-N |
| XLogP | 3.52 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|