C20H23F3N4O2S — CID 135589758
2-[(2E,5R)-2-(cyclooctylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 135589758) has the molecular formula C20H23F3N4O2S and a molecular weight of 440.49 g/mol. Its IUPAC name is 2-[(2E,5R)-2-(cyclooctylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(2E,5R)-2-(cyclooctylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 135589758 |
| Molecular Formula | C20H23F3N4O2S |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[(2E,5R)-2-(cyclooctylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(C[C@H]1S/C(=N/N=C2CCCCCCC2)NC1=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H23F3N4O2S/c21-20(22,23)13-7-6-10-15(11-13)24-17(28)12-16-18(29)25-19(30-16)27-26-14-8-4-2-1-3-5-9-14/h6-7,10-11,16H,1-5,8-9,12H2,(H,24,28)(H,25,27,29)/t16-/m1/s1 |
| InChIKey | MWDLRJIWVAKLCG-MRXNPFEDSA-N |
| XLogP | 4.72 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|