C22H25F3N4O2S — CID 136912535
2-[(2E,5S)-4-oxo-2-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 136912535) has the molecular formula C22H25F3N4O2S and a molecular weight of 466.53 g/mol. Its IUPAC name is 2-[(2E,5S)-4-oxo-2-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(2E,5S)-4-oxo-2-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 136912535 |
| Molecular Formula | C22H25F3N4O2S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-[(2E,5S)-4-oxo-2-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)/C(=N/N=C1\NC(=O)[C@H](CC(=O)Nc3cccc(C(F)(F)F)c3)S1)C2 |
| InChI | InChI=1S/C22H25F3N4O2S/c1-20(2)12-7-8-21(20,3)16(10-12)28-29-19-27-18(31)15(32-19)11-17(30)26-14-6-4-5-13(9-14)22(23,24)25/h4-6,9,12,15H,7-8,10-11H2,1-3H3,(H,26,30)(H,27,29,31)/b28-16+/t12-,15+,21-/m1/s1 |
| InChIKey | XXWMHCISGMYXJS-BKFWXSDTSA-N |
| XLogP | 4.82 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|