C21H23F3N4O2S — CID 137206966
2-[(5S)-4-oxo-2-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 137206966) has the molecular formula C21H23F3N4O2S and a molecular weight of 452.50 g/mol. Its IUPAC name is 2-[(5S)-4-oxo-2-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(5S)-4-oxo-2-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 137206966 |
| Molecular Formula | C21H23F3N4O2S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-[(5S)-4-oxo-2-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC1=CC(=NN=C2NC(=O)[C@H](CC(=O)Nc3cccc(C(F)(F)F)c3)S2)CC(C)(C)C1 |
| InChI | InChI=1S/C21H23F3N4O2S/c1-12-7-15(11-20(2,3)10-12)27-28-19-26-18(30)16(31-19)9-17(29)25-14-6-4-5-13(8-14)21(22,23)24/h4-8,16H,9-11H2,1-3H3,(H,25,29)(H,26,28,30)/t16-/m0/s1 |
| InChIKey | MSBSBIQZJPVVJH-INIZCTEOSA-N |
| XLogP | 4.74 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|