C14H18N3O3S- — CID 135764306
2-[(2E,5R)-4-oxo-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetate (PubChem CID 135764306) has the molecular formula C14H18N3O3S- and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[(2E,5R)-4-oxo-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2E,5R)-4-oxo-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135764306 |
| Molecular Formula | C14H18N3O3S- |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-[(2E,5R)-4-oxo-2-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]acetate |
| SMILES | CC1=C/C(=N\N=C2/NC(=O)[C@@H](CC(=O)[O-])S2)CC(C)(C)C1 |
| InChI | InChI=1S/C14H19N3O3S/c1-8-4-9(7-14(2,3)6-8)16-17-13-15-12(20)10(21-13)5-11(18)19/h4,10H,5-7H2,1-3H3,(H,18,19)(H,15,17,20)/p-1/b16-9+/t10-/m1/s1 |
| InChIKey | HTROGAJFRPSZMM-VCBXAZPMSA-M |
| XLogP | 0.84 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|