C15H22N3O3S- — CID 135608711
2-[(2Z,5S)-2-[(4-tert-butylcyclohexylidene)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135608711) has the molecular formula C15H22N3O3S- and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-[(2Z,5S)-2-[(4-tert-butylcyclohexylidene)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2Z,5S)-2-[(4-tert-butylcyclohexylidene)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135608711 |
| Molecular Formula | C15H22N3O3S- |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-[(2Z,5S)-2-[(4-tert-butylcyclohexylidene)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | CC(C)(C)C1CCC(=N/N=C2/NC(=O)[C@H](CC(=O)[O-])S2)CC1 |
| InChI | InChI=1S/C15H23N3O3S/c1-15(2,3)9-4-6-10(7-5-9)17-18-14-16-13(21)11(22-14)8-12(19)20/h9,11H,4-8H2,1-3H3,(H,19,20)(H,16,18,21)/p-1/b17-10-/t9?,11-/m0/s1 |
| InChIKey | BTUTVDJNWMNRMQ-YWPFCDBSSA-M |
| XLogP | 1.31 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|