C13H18N3O3S- — CID 135831017
2-[(2Z,5R)-2-[(4-ethylcyclohexylidene)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135831017) has the molecular formula C13H18N3O3S- and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-[(4-ethylcyclohexylidene)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2Z,5R)-2-[(4-ethylcyclohexylidene)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135831017 |
| Molecular Formula | C13H18N3O3S- |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-[(2Z,5R)-2-[(4-ethylcyclohexylidene)hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | CCC1CCC(=N/N=C2/NC(=O)[C@@H](CC(=O)[O-])S2)CC1 |
| InChI | InChI=1S/C13H19N3O3S/c1-2-8-3-5-9(6-4-8)15-16-13-14-12(19)10(20-13)7-11(17)18/h8,10H,2-7H2,1H3,(H,17,18)(H,14,16,19)/p-1/b15-9-/t8?,10-/m1/s1 |
| InChIKey | XWHHCWIAASAVHJ-NQYVCRDFSA-M |
| XLogP | 0.67 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|