C9H12N3O3S- — CID 135568896
2-[(2Z,5R)-2-[(Z)-butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate (PubChem CID 135568896) has the molecular formula C9H12N3O3S- and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-[(2Z,5R)-2-[(Z)-butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate.
| Compound Name | 2-[(2Z,5R)-2-[(Z)-butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
|---|---|
| PubChem CID | 135568896 |
| Molecular Formula | C9H12N3O3S- |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-[(2Z,5R)-2-[(Z)-butan-2-ylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetate |
| SMILES | CC/C(C)=N\N=C1\NC(=O)[C@@H](CC(=O)[O-])S1 |
| InChI | InChI=1S/C9H13N3O3S/c1-3-5(2)11-12-9-10-8(15)6(16-9)4-7(13)14/h6H,3-4H2,1-2H3,(H,13,14)(H,10,12,15)/p-1/b11-5-/t6-/m1/s1 |
| InChIKey | DFIQZUIFUUDGGC-XDELZERXSA-M |
| XLogP | -0.50 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|