C17H19N5O4S — CID 86261538
2-[(2E)-2-(cyclohexylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-nitrophenyl)acetamide (PubChem CID 86261538) has the molecular formula C17H19N5O4S and a molecular weight of 389.44 g/mol. Its IUPAC name is 2-[(2E)-2-(cyclohexylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(2E)-2-(cyclohexylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 86261538 |
| Molecular Formula | C17H19N5O4S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-[(2E)-2-(cyclohexylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CC1S/C(=N/N=C2CCCCC2)NC1=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H19N5O4S/c23-15(18-11-6-8-13(9-7-11)22(25)26)10-14-16(24)19-17(27-14)21-20-12-4-2-1-3-5-12/h6-9,14H,1-5,10H2,(H,18,23)(H,19,21,24) |
| InChIKey | FQFCMDUHICBNIX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|