C15H12F3N5O3S2 — CID 135924867
2-[(2E,5S)-4-oxo-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 135924867) has the molecular formula C15H12F3N5O3S2 and a molecular weight of 431.42 g/mol. Its IUPAC name is 2-[(2E,5S)-4-oxo-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(2E,5S)-4-oxo-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 135924867 |
| Molecular Formula | C15H12F3N5O3S2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 2-[(2E,5S)-4-oxo-2-[(E)-(2-oxo-1,3-thiazolidin-4-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(C[C@@H]1S/C(=N/N=C2\CSC(=O)N2)NC1=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F3N5O3S2/c16-15(17,18)7-2-1-3-8(4-7)19-11(24)5-9-12(25)21-13(28-9)23-22-10-6-27-14(26)20-10/h1-4,9H,5-6H2,(H,19,24)(H,20,22,26)(H,21,23,25)/t9-/m0/s1 |
| InChIKey | QKJZCTCLCNDBON-VIFPVBQESA-N |
| XLogP | 2.39 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|