C21H25ClN4O2S — CID 136910586
N-(4-chlorophenyl)-2-[(2E,5S)-4-oxo-2-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 136910586) has the molecular formula C21H25ClN4O2S and a molecular weight of 432.98 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(2E,5S)-4-oxo-2-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(2E,5S)-4-oxo-2-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 136910586 |
| Molecular Formula | C21H25ClN4O2S |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(2E,5S)-4-oxo-2-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)/C(=N/N=C1\NC(=O)[C@H](CC(=O)Nc3ccc(Cl)cc3)S1)C2 |
| InChI | InChI=1S/C21H25ClN4O2S/c1-20(2)12-8-9-21(20,3)16(10-12)25-26-19-24-18(28)15(29-19)11-17(27)23-14-6-4-13(22)5-7-14/h4-7,12,15H,8-11H2,1-3H3,(H,23,27)(H,24,26,28)/b25-16+/t12-,15-,21-/m0/s1 |
| InChIKey | STBSAECSVDKQLU-DBIMNTDNSA-N |
| XLogP | 4.46 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|