C19H18N4O3S2 — CID 135868040
N-(4-acetylphenyl)-2-[(2Z,5S)-4-oxo-2-[(Z)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135868040) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[(2Z,5S)-4-oxo-2-[(Z)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-[(2Z,5S)-4-oxo-2-[(Z)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135868040 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N-(4-acetylphenyl)-2-[(2Z,5S)-4-oxo-2-[(Z)-1-thiophen-2-ylethylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)C[C@@H]2S/C(=N\N=C(\C)c3cccs3)NC2=O)cc1 |
| InChI | InChI=1S/C19H18N4O3S2/c1-11(15-4-3-9-27-15)22-23-19-21-18(26)16(28-19)10-17(25)20-14-7-5-13(6-8-14)12(2)24/h3-9,16H,10H2,1-2H3,(H,20,25)(H,21,23,26)/b22-11-/t16-/m0/s1 |
| InChIKey | NZJSSLYREVXJRZ-VBHHZLGVSA-N |
| XLogP | 3.29 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|