C22H21N5O5S — CID 135933076
4-[[2-[(2E,5S)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid (PubChem CID 135933076) has the molecular formula C22H21N5O5S and a molecular weight of 467.51 g/mol. Its IUPAC name is 4-[[2-[(2E,5S)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[(2E,5S)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 135933076 |
| Molecular Formula | C22H21N5O5S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-[[2-[(2E,5S)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid |
| SMILES | CC(=O)Nc1cccc(/C(C)=N\N=C2/NC(=O)[C@H](CC(=O)Nc3ccc(C(=O)O)cc3)S2)c1 |
| InChI | InChI=1S/C22H21N5O5S/c1-12(15-4-3-5-17(10-15)23-13(2)28)26-27-22-25-20(30)18(33-22)11-19(29)24-16-8-6-14(7-9-16)21(31)32/h3-10,18H,11H2,1-2H3,(H,23,28)(H,24,29)(H,31,32)(H,25,27,30)/b26-12-/t18-/m0/s1 |
| InChIKey | RGBGZWOXEWOEEX-KZSFWESRSA-N |
| XLogP | 2.68 |
| TPSA | 149.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|