C21H19Cl2N5O3S — CID 135877657
2-[(2E,5R)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 135877657) has the molecular formula C21H19Cl2N5O3S and a molecular weight of 492.39 g/mol. Its IUPAC name is 2-[(2E,5R)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[(2E,5R)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 135877657 |
| Molecular Formula | C21H19Cl2N5O3S |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 2-[(2E,5R)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | CC(=O)Nc1cccc(/C(C)=N\N=C2/NC(=O)[C@@H](CC(=O)Nc3cccc(Cl)c3Cl)S2)c1 |
| InChI | InChI=1S/C21H19Cl2N5O3S/c1-11(13-5-3-6-14(9-13)24-12(2)29)27-28-21-26-20(31)17(32-21)10-18(30)25-16-8-4-7-15(22)19(16)23/h3-9,17H,10H2,1-2H3,(H,24,29)(H,25,30)(H,26,28,31)/b27-11-/t17-/m1/s1 |
| InChIKey | GIFJEABLMUJUQN-XUEJJAAKSA-N |
| XLogP | 4.29 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|