C21H21ClN4O2S — CID 135934467
2-[(2E,5R)-2-[(Z)-1-(4-chlorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 135934467) has the molecular formula C21H21ClN4O2S and a molecular weight of 428.95 g/mol. Its IUPAC name is 2-[(2E,5R)-2-[(Z)-1-(4-chlorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[(2E,5R)-2-[(Z)-1-(4-chlorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 135934467 |
| Molecular Formula | C21H21ClN4O2S |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-[(2E,5R)-2-[(Z)-1-(4-chlorophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | C/C(=N/N=C1\NC(=O)[C@@H](CC(=O)Nc2cccc(C)c2C)S1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN4O2S/c1-12-5-4-6-17(13(12)2)23-19(27)11-18-20(28)24-21(29-18)26-25-14(3)15-7-9-16(22)10-8-15/h4-10,18H,11H2,1-3H3,(H,23,27)(H,24,26,28)/b25-14-/t18-/m1/s1 |
| InChIKey | DGZFADBTLIOTRZ-DBXOKZBGSA-N |
| XLogP | 4.30 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|