C17H21N5O3S — CID 135659652
2-[(2E,5S)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-ethylacetamide (PubChem CID 135659652) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is 2-[(2E,5S)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-ethylacetamide.
| Compound Name | 2-[(2E,5S)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 135659652 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-[(2E,5S)-2-[(Z)-1-(3-acetamidophenyl)ethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)C[C@@H]1S/C(=N/N=C(/C)c2cccc(NC(C)=O)c2)NC1=O |
| InChI | InChI=1S/C17H21N5O3S/c1-4-18-15(24)9-14-16(25)20-17(26-14)22-21-10(2)12-6-5-7-13(8-12)19-11(3)23/h5-8,14H,4,9H2,1-3H3,(H,18,24)(H,19,23)(H,20,22,25)/b21-10-/t14-/m0/s1 |
| InChIKey | NVMXZVIXCWKQFV-LKEIMFIWSA-N |
| XLogP | 1.48 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|