C15H18BrN3O2S — CID 135691786
N-(4-bromophenyl)-2-[(5R)-2-butylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135691786) has the molecular formula C15H18BrN3O2S and a molecular weight of 384.30 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(5R)-2-butylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[(5R)-2-butylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135691786 |
| Molecular Formula | C15H18BrN3O2S |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | N-(4-bromophenyl)-2-[(5R)-2-butylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCCC/N=C1\NC(=O)[C@@H](CC(=O)Nc2ccc(Br)cc2)S1 |
| InChI | InChI=1S/C15H18BrN3O2S/c1-2-3-8-17-15-19-14(21)12(22-15)9-13(20)18-11-6-4-10(16)5-7-11/h4-7,12H,2-3,8-9H2,1H3,(H,18,20)(H,17,19,21)/t12-/m1/s1 |
| InChIKey | GBMQGORDIMHNBO-GFCCVEGCSA-N |
| XLogP | 3.17 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|