C16H19Cl2N3O3S — CID 135705027
N-(3,4-dichlorophenyl)-2-[(5R)-2-(3-ethoxypropylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135705027) has the molecular formula C16H19Cl2N3O3S and a molecular weight of 404.32 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[(5R)-2-(3-ethoxypropylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[(5R)-2-(3-ethoxypropylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135705027 |
| Molecular Formula | C16H19Cl2N3O3S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[(5R)-2-(3-ethoxypropylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCOCCC/N=C1\NC(=O)[C@@H](CC(=O)Nc2ccc(Cl)c(Cl)c2)S1 |
| InChI | InChI=1S/C16H19Cl2N3O3S/c1-2-24-7-3-6-19-16-21-15(23)13(25-16)9-14(22)20-10-4-5-11(17)12(18)8-10/h4-5,8,13H,2-3,6-7,9H2,1H3,(H,20,22)(H,19,21,23)/t13-/m1/s1 |
| InChIKey | YHGNGTQEVYAICF-CYBMUJFWSA-N |
| XLogP | 3.34 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|