C14H15Cl2N3O3S — CID 135797682
N-(3,5-dichlorophenyl)-2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135797682) has the molecular formula C14H15Cl2N3O3S and a molecular weight of 376.27 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135797682 |
| Molecular Formula | C14H15Cl2N3O3S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COCC/N=C1\NC(=O)[C@H](CC(=O)Nc2cc(Cl)cc(Cl)c2)S1 |
| InChI | InChI=1S/C14H15Cl2N3O3S/c1-22-3-2-17-14-19-13(21)11(23-14)7-12(20)18-10-5-8(15)4-9(16)6-10/h4-6,11H,2-3,7H2,1H3,(H,18,20)(H,17,19,21)/t11-/m0/s1 |
| InChIKey | MXFKQVYBEWITEP-NSHDSACASA-N |
| XLogP | 2.56 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|