C15H19N3O4S — CID 135691436
2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 135691436) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135691436 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COCC/N=C1\NC(=O)[C@H](CC(=O)Nc2cccc(OC)c2)S1 |
| InChI | InChI=1S/C15H19N3O4S/c1-21-7-6-16-15-18-14(20)12(23-15)9-13(19)17-10-4-3-5-11(8-10)22-2/h3-5,8,12H,6-7,9H2,1-2H3,(H,17,19)(H,16,18,20)/t12-/m0/s1 |
| InChIKey | WMYOUFRZRIAIEI-LBPRGKRZSA-N |
| XLogP | 1.26 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|