C17H23N3O4S — CID 135705020
2-[(5R)-2-(3-ethoxypropylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 135705020) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-[(5R)-2-(3-ethoxypropylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(5R)-2-(3-ethoxypropylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135705020 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[(5R)-2-(3-ethoxypropylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | CCOCCC/N=C1\NC(=O)[C@@H](CC(=O)Nc2cccc(OC)c2)S1 |
| InChI | InChI=1S/C17H23N3O4S/c1-3-24-9-5-8-18-17-20-16(22)14(25-17)11-15(21)19-12-6-4-7-13(10-12)23-2/h4,6-7,10,14H,3,5,8-9,11H2,1-2H3,(H,19,21)(H,18,20,22)/t14-/m1/s1 |
| InChIKey | NESMYKZLRDUJMV-CQSZACIVSA-N |
| XLogP | 2.04 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|