C15H16F3N3O4S — CID 135704805
2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 135704805) has the molecular formula C15H16F3N3O4S and a molecular weight of 391.37 g/mol. Its IUPAC name is 2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 135704805 |
| Molecular Formula | C15H16F3N3O4S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | COCC/N=C1\NC(=O)[C@H](CC(=O)Nc2ccc(OC(F)(F)F)cc2)S1 |
| InChI | InChI=1S/C15H16F3N3O4S/c1-24-7-6-19-14-21-13(23)11(26-14)8-12(22)20-9-2-4-10(5-3-9)25-15(16,17)18/h2-5,11H,6-8H2,1H3,(H,20,22)(H,19,21,23)/t11-/m0/s1 |
| InChIKey | PNFVROHAEVKFHX-NSHDSACASA-N |
| XLogP | 2.15 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|