C15H15ClF3N3O3S — CID 135691464
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5R)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135691464) has the molecular formula C15H15ClF3N3O3S and a molecular weight of 409.82 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5R)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5R)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135691464 |
| Molecular Formula | C15H15ClF3N3O3S |
| Molecular Weight | 409.82 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[(5R)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COCC/N=C1\NC(=O)[C@@H](CC(=O)Nc2cc(C(F)(F)F)ccc2Cl)S1 |
| InChI | InChI=1S/C15H15ClF3N3O3S/c1-25-5-4-20-14-22-13(24)11(26-14)7-12(23)21-10-6-8(15(17,18)19)2-3-9(10)16/h2-3,6,11H,4-5,7H2,1H3,(H,21,23)(H,20,22,24)/t11-/m1/s1 |
| InChIKey | LGBZAOKYAOXRSJ-LLVKDONJSA-N |
| XLogP | 2.92 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.82 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|